About methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate
methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate (PubChem CID 135041149) has the molecular formula C10H13F3O4
and a molecular weight of 254.20 g/mol. Its IUPAC name is methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate |
| PubChem CID | 135041149 |
| Molecular Formula | C10H13F3O4 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate |
| SMILES | COC(=O)C(=C[C@H]1COC(C)(C)O1)C(F)(F)F |
| InChI | InChI=1S/C10H13F3O4/c1-9(2)16-5-6(17-9)4-7(8(14)15-3)10(11,12)13/h4,6H,5H2,1-3H3/t6-/m0/s1 |
| InChIKey | RAYVWBSUVSINJZ-LURJTMIESA-N |
| XLogP | 1.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate?
The IUPAC name of methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate (CID 135041149) is methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate.
What is the SMILES notation for methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate?
The canonical SMILES for methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate is COC(=O)C(=C[C@H]1COC(C)(C)O1)C(F)(F)F.
What is the InChIKey of methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate?
The InChIKey is RAYVWBSUVSINJZ-LURJTMIESA-N. The full InChI is InChI=1S/C10H13F3O4/c1-9(2)16-5-6(17-9)4-7(8(14)15-3)10(11,12)13/h4,6H,5H2,1-3H3/t6-/m0/s1.
What are the key properties of methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate?
methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate has a molecular weight of 254.20 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)prop-2-enoate is sourced from PubChem (CID 135041149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).