C10H11IO6 — CID 135041164
dimethyl (1S,5S,6S,7S)-7-iodo-3-oxo-2-oxabicyclo[3.2.0]heptane-4,6-dicarboxylate (PubChem CID 135041164) has the molecular formula C10H11IO6 and a molecular weight of 354.10 g/mol. Its IUPAC name is dimethyl (1S,5S,6S,7S)-7-iodo-3-oxo-2-oxabicyclo[3.2.0]heptane-4,6-dicarboxylate.
| Compound Name | dimethyl (1S,5S,6S,7S)-7-iodo-3-oxo-2-oxabicyclo[3.2.0]heptane-4,6-dicarboxylate |
|---|---|
| PubChem CID | 135041164 |
| Molecular Formula | C10H11IO6 |
| Molecular Weight | 354.10 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | dimethyl (1S,5S,6S,7S)-7-iodo-3-oxo-2-oxabicyclo[3.2.0]heptane-4,6-dicarboxylate |
| SMILES | COC(=O)C1C(=O)O[C@@H]2[C@@H](I)[C@H](C(=O)OC)[C@H]12 |
| InChI | InChI=1S/C10H11IO6/c1-15-8(12)4-3-5(9(13)16-2)10(14)17-7(3)6(4)11/h3-7H,1-2H3/t3-,4-,5?,6+,7+/m1/s1 |
| InChIKey | KUJBQPXDEPDLGN-HBNZSLMYSA-N |
| XLogP | -0.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.10 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|