About N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine
N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine (PubChem CID 135041410) has the molecular formula C16H16N2S
and a molecular weight of 268.38 g/mol. Its IUPAC name is N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine.
Molecular Properties
| Compound Name | N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine |
| PubChem CID | 135041410 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine |
| SMILES | CN1Cc2ccccc2S/C1=N\Cc1ccccc1 |
| InChI | InChI=1S/C16H16N2S/c1-18-12-14-9-5-6-10-15(14)19-16(18)17-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3/b17-16- |
| InChIKey | ZAGIDJFLLWVKHZ-MSUUIHNZSA-N |
| XLogP | 3.78 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine?
The IUPAC name of N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine (CID 135041410) is N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine.
What is the SMILES notation for N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine?
The canonical SMILES for N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine is CN1Cc2ccccc2S/C1=N\Cc1ccccc1.
What is the InChIKey of N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine?
The InChIKey is ZAGIDJFLLWVKHZ-MSUUIHNZSA-N. The full InChI is InChI=1S/C16H16N2S/c1-18-12-14-9-5-6-10-15(14)19-16(18)17-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3/b17-16-.
What are the key properties of N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine?
N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine has a molecular weight of 268.38 g/mol, XLogP of 3.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-methyl-4H-1,3-benzothiazin-2-imine is sourced from PubChem (CID 135041410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).