About methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate
methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate (PubChem CID 135041573) has the molecular formula C11H14FNO4
and a molecular weight of 243.23 g/mol. Its IUPAC name is methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate.
Molecular Properties
| Compound Name | methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate |
| PubChem CID | 135041573 |
| Molecular Formula | C11H14FNO4 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate |
| SMILES | COC(=O)N1C=CC2C(F)C1OC(=O)C2(C)C |
| InChI | InChI=1S/C11H14FNO4/c1-11(2)6-4-5-13(10(15)16-3)8(7(6)12)17-9(11)14/h4-8H,1-3H3 |
| InChIKey | MDSBMBALSDTNAG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate?
The IUPAC name of methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate (CID 135041573) is methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate.
What is the SMILES notation for methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate?
The canonical SMILES for methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate is COC(=O)N1C=CC2C(F)C1OC(=O)C2(C)C.
What is the InChIKey of methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate?
The InChIKey is MDSBMBALSDTNAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO4/c1-11(2)6-4-5-13(10(15)16-3)8(7(6)12)17-9(11)14/h4-8H,1-3H3.
What are the key properties of methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate?
methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate has a molecular weight of 243.23 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-fluoro-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate is sourced from PubChem (CID 135041573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).