C14H21NO3 — CID 135041661
ethyl (1R,4aS,5R,8aR)-4a-cyano-5-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1-carboxylate (PubChem CID 135041661) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is ethyl (1R,4aS,5R,8aR)-4a-cyano-5-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1R,4aS,5R,8aR)-4a-cyano-5-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 135041661 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | ethyl (1R,4aS,5R,8aR)-4a-cyano-5-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[C@]2(C#N)[C@H](O)CCC[C@H]12 |
| InChI | InChI=1S/C14H21NO3/c1-2-18-13(17)10-5-4-8-14(9-15)11(10)6-3-7-12(14)16/h10-12,16H,2-8H2,1H3/t10-,11-,12-,14-/m1/s1 |
| InChIKey | GBEOCBYZEDHRCW-HKUMRIAESA-N |
| XLogP | 2.02 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |