C34H52O5Si — CID 135041710
(1S,2S,3aS)-1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7a-(3-hydroxypropyl)-7-(methoxymethoxy)-5-methyl-1,2,3,3a,4,5,6,7-octahydroinden-2-ol (PubChem CID 135041710) has the molecular formula C34H52O5Si and a molecular weight of 568.87 g/mol. Its IUPAC name is (1S,2S,3aS)-1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7a-(3-hydroxypropyl)-7-(methoxymethoxy)-5-methyl-1,2,3,3a,4,5,6,7-octahydroinden-2-ol.
| Compound Name | (1S,2S,3aS)-1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7a-(3-hydroxypropyl)-7-(methoxymethoxy)-5-methyl-1,2,3,3a,4,5,6,7-octahydroinden-2-ol |
|---|---|
| PubChem CID | 135041710 |
| Molecular Formula | C34H52O5Si |
| Molecular Weight | 568.87 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | (1S,2S,3aS)-1-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-7a-(3-hydroxypropyl)-7-(methoxymethoxy)-5-methyl-1,2,3,3a,4,5,6,7-octahydroinden-2-ol |
| SMILES | COCOC1CC(C)C[C@H]2C[C@H](O)[C@@H](CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C12CCCO |
| InChI | InChI=1S/C34H52O5Si/c1-26-22-27-24-31(36)30(34(27,19-13-20-35)32(23-26)38-25-37-5)18-12-21-39-40(33(2,3)4,28-14-8-6-9-15-28)29-16-10-7-11-17-29/h6-11,14-17,26-27,30-32,35-36H,12-13,18-25H2,1-5H3/t26?,27-,30+,31-,32?,34?/m0/s1 |
| InChIKey | MDDSXQCCIDPSFQ-AWYSFQABSA-N |
| XLogP | 5.52 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.87 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|