About (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol
(5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol (PubChem CID 135041845) has the molecular formula C18H30OSi
and a molecular weight of 290.52 g/mol. Its IUPAC name is (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol.
Molecular Properties
| Compound Name | (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol |
| PubChem CID | 135041845 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol |
| SMILES | C=CCC[C@@H](O)C#CC#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H30OSi/c1-8-9-12-18(19)13-10-11-14-20(15(2)3,16(4)5)17(6)7/h8,15-19H,1,9,12H2,2-7H3/t18-/m1/s1 |
| InChIKey | JXQYDQUYKJPCAI-GOSISDBHSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol?
The IUPAC name of (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol (CID 135041845) is (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol.
What is the SMILES notation for (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol?
The canonical SMILES for (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol is C=CCC[C@@H](O)C#CC#C[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol?
The InChIKey is JXQYDQUYKJPCAI-GOSISDBHSA-N. The full InChI is InChI=1S/C18H30OSi/c1-8-9-12-18(19)13-10-11-14-20(15(2)3,16(4)5)17(6)7/h8,15-19H,1,9,12H2,2-7H3/t18-/m1/s1.
What are the key properties of (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol?
(5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol has a molecular weight of 290.52 g/mol, XLogP of 4.54, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1-tri(propan-2-yl)silylnon-8-en-1,3-diyn-5-ol is sourced from PubChem (CID 135041845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).