About 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene
2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene (PubChem CID 135041889) has the molecular formula C12H14Se
and a molecular weight of 237.20 g/mol. Its IUPAC name is 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene.
Molecular Properties
| Compound Name | 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene |
| PubChem CID | 135041889 |
| Molecular Formula | C12H14Se |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene |
| SMILES | C=C(C)/C=C/c1[se]ccc1C(=C)C |
| InChI | InChI=1S/C12H14Se/c1-9(2)5-6-12-11(10(3)4)7-8-13-12/h5-8H,1,3H2,2,4H3/b6-5+ |
| InChIKey | ORBKREJBMWWHBE-AATRIKPKSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene?
The IUPAC name of 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene (CID 135041889) is 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene.
What is the SMILES notation for 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene?
The canonical SMILES for 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene is C=C(C)/C=C/c1[se]ccc1C(=C)C.
What is the InChIKey of 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene?
The InChIKey is ORBKREJBMWWHBE-AATRIKPKSA-N. The full InChI is InChI=1S/C12H14Se/c1-9(2)5-6-12-11(10(3)4)7-8-13-12/h5-8H,1,3H2,2,4H3/b6-5+.
What are the key properties of 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene?
2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene has a molecular weight of 237.20 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-3-methylbuta-1,3-dienyl]-3-prop-1-en-2-ylselenophene is sourced from PubChem (CID 135041889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).