C15H20O4 — CID 135041940
methyl (2S,8R)-2,8-dimethyl-7-oxo-8-(2-oxopropyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 135041940) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl (2S,8R)-2,8-dimethyl-7-oxo-8-(2-oxopropyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (2S,8R)-2,8-dimethyl-7-oxo-8-(2-oxopropyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 135041940 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | methyl (2S,8R)-2,8-dimethyl-7-oxo-8-(2-oxopropyl)bicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC2C=CC1C(=O)[C@]2(C)CC(C)=O |
| InChI | InChI=1S/C15H20O4/c1-9(16)7-14(2)10-5-6-11(12(14)17)15(3,8-10)13(18)19-4/h5-6,10-11H,7-8H2,1-4H3/t10?,11?,14-,15+/m1/s1 |
| InChIKey | XNLDKCPBCVJHBT-FBDPFYNOSA-N |
| XLogP | 1.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|