About CID 135041965
CID 135041965 (PubChem CID 135041965) has the molecular formula C7H10OSi+
and a molecular weight of 138.24 g/mol.
Molecular Properties
| Compound Name | CID 135041965 |
| PubChem CID | 135041965 |
| Molecular Formula | C7H10OSi+ |
| Molecular Weight | 138.24 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | — |
| SMILES | CC1C[C+]=C([Si])C(C)O1 |
| InChI | InChI=1S/C7H10OSi/c1-5-3-4-7(9)6(2)8-5/h5-6H,3H2,1-2H3/q+1 |
| InChIKey | LNBUBIDUEUIVIU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 135041965 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135041965?
The IUPAC name of CID 135041965 (CID 135041965) is not available.
What is the SMILES notation for CID 135041965?
The canonical SMILES for CID 135041965 is CC1C[C+]=C([Si])C(C)O1.
What is the InChIKey of CID 135041965?
The InChIKey is LNBUBIDUEUIVIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10OSi/c1-5-3-4-7(9)6(2)8-5/h5-6H,3H2,1-2H3/q+1.
What are the key properties of CID 135041965?
CID 135041965 has a molecular weight of 138.24 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135041965 is sourced from PubChem (CID 135041965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).