C13H16O2 — CID 135042302
(5R)-5-hydroxy-12-methyltricyclo[6.2.2.01,6]dodeca-3,11-dien-10-one (PubChem CID 135042302) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (5R)-5-hydroxy-12-methyltricyclo[6.2.2.01,6]dodeca-3,11-dien-10-one.
| Compound Name | (5R)-5-hydroxy-12-methyltricyclo[6.2.2.01,6]dodeca-3,11-dien-10-one |
|---|---|
| PubChem CID | 135042302 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (5R)-5-hydroxy-12-methyltricyclo[6.2.2.01,6]dodeca-3,11-dien-10-one |
| SMILES | CC1=CC23CC=C[C@@H](O)C2CC1CC3=O |
| InChI | InChI=1S/C13H16O2/c1-8-7-13-4-2-3-11(14)10(13)5-9(8)6-12(13)15/h2-3,7,9-11,14H,4-6H2,1H3/t9?,10?,11-,13?/m1/s1 |
| InChIKey | KIGDJOXSQJMPHC-XPOXDWOYSA-N |
| XLogP | 1.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|