About (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan
(4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan (PubChem CID 135042319) has the molecular formula C14H9F3OS
and a molecular weight of 282.29 g/mol. Its IUPAC name is (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan.
Molecular Properties
| Compound Name | (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan |
| PubChem CID | 135042319 |
| Molecular Formula | C14H9F3OS |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan |
| SMILES | FC(F)(F)C1O/C(=C\c2ccccc2)c2ccsc21 |
| InChI | InChI=1S/C14H9F3OS/c15-14(16,17)13-12-10(6-7-19-12)11(18-13)8-9-4-2-1-3-5-9/h1-8,13H/b11-8- |
| InChIKey | ZKSOOYZLVFVVKW-FLIBITNWSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan?
The IUPAC name of (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan (CID 135042319) is (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan.
What is the SMILES notation for (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan?
The canonical SMILES for (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan is FC(F)(F)C1O/C(=C\c2ccccc2)c2ccsc21.
What is the InChIKey of (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan?
The InChIKey is ZKSOOYZLVFVVKW-FLIBITNWSA-N. The full InChI is InChI=1S/C14H9F3OS/c15-14(16,17)13-12-10(6-7-19-12)11(18-13)8-9-4-2-1-3-5-9/h1-8,13H/b11-8-.
What are the key properties of (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan?
(4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan has a molecular weight of 282.29 g/mol, XLogP of 4.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-benzylidene-6-(trifluoromethyl)-6H-thieno[2,3-c]furan is sourced from PubChem (CID 135042319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).