C11H15F4NO2 — CID 135042450
(3aS,7aR)-3-hydroxy-2-methyl-3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6,7,7a-hexahydroisoindol-1-one (PubChem CID 135042450) has the molecular formula C11H15F4NO2 and a molecular weight of 269.24 g/mol. Its IUPAC name is (3aS,7aR)-3-hydroxy-2-methyl-3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6,7,7a-hexahydroisoindol-1-one.
| Compound Name | (3aS,7aR)-3-hydroxy-2-methyl-3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6,7,7a-hexahydroisoindol-1-one |
|---|---|
| PubChem CID | 135042450 |
| Molecular Formula | C11H15F4NO2 |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (3aS,7aR)-3-hydroxy-2-methyl-3-(1,1,2,2-tetrafluoroethyl)-3a,4,5,6,7,7a-hexahydroisoindol-1-one |
| SMILES | CN1C(=O)[C@@H]2CCCC[C@@H]2C1(O)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H15F4NO2/c1-16-8(17)6-4-2-3-5-7(6)11(16,18)10(14,15)9(12)13/h6-7,9,18H,2-5H2,1H3/t6-,7+,11?/m1/s1 |
| InChIKey | CJRZLAVTGQVYQW-ZBRSCZCWSA-N |
| XLogP | 1.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|