C11H19NO3 — CID 135042580
(2E,5S)-5-hydroxy-N-methoxy-N,4,4-trimethylhepta-2,6-dienamide (PubChem CID 135042580) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (2E,5S)-5-hydroxy-N-methoxy-N,4,4-trimethylhepta-2,6-dienamide.
| Compound Name | (2E,5S)-5-hydroxy-N-methoxy-N,4,4-trimethylhepta-2,6-dienamide |
|---|---|
| PubChem CID | 135042580 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (2E,5S)-5-hydroxy-N-methoxy-N,4,4-trimethylhepta-2,6-dienamide |
| SMILES | C=C[C@H](O)C(C)(C)/C=C/C(=O)N(C)OC |
| InChI | InChI=1S/C11H19NO3/c1-6-9(13)11(2,3)8-7-10(14)12(4)15-5/h6-9,13H,1H2,2-5H3/b8-7+/t9-/m0/s1 |
| InChIKey | HMLSPNJVBAQLHB-FLOXNTQESA-N |
| XLogP | 1.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|