C11H10ClF3O2 — CID 135042892
(4R)-4-(4-chlorophenyl)-5,5,5-trifluoro-4-hydroxypentan-2-one (PubChem CID 135042892) has the molecular formula C11H10ClF3O2 and a molecular weight of 266.65 g/mol. Its IUPAC name is (4R)-4-(4-chlorophenyl)-5,5,5-trifluoro-4-hydroxypentan-2-one.
| Compound Name | (4R)-4-(4-chlorophenyl)-5,5,5-trifluoro-4-hydroxypentan-2-one |
|---|---|
| PubChem CID | 135042892 |
| Molecular Formula | C11H10ClF3O2 |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | (4R)-4-(4-chlorophenyl)-5,5,5-trifluoro-4-hydroxypentan-2-one |
| SMILES | CC(=O)C[C@@](O)(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H10ClF3O2/c1-7(16)6-10(17,11(13,14)15)8-2-4-9(12)5-3-8/h2-5,17H,6H2,1H3/t10-/m1/s1 |
| InChIKey | ZSJVIAJPFOBFLL-SNVBAGLBSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |