About 4-oxodec-9-en-5-ynal
4-oxodec-9-en-5-ynal (PubChem CID 135043051) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 4-oxodec-9-en-5-ynal.
Molecular Properties
| Compound Name | 4-oxodec-9-en-5-ynal |
| PubChem CID | 135043051 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 4-oxodec-9-en-5-ynal |
| SMILES | C=CCCC#CC(=O)CCC=O |
| InChI | InChI=1S/C10H12O2/c1-2-3-4-5-7-10(12)8-6-9-11/h2,9H,1,3-4,6,8H2 |
| InChIKey | HUBULAWQCVBLNX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-oxodec-9-en-5-ynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxodec-9-en-5-ynal?
The IUPAC name of 4-oxodec-9-en-5-ynal (CID 135043051) is 4-oxodec-9-en-5-ynal.
What is the SMILES notation for 4-oxodec-9-en-5-ynal?
The canonical SMILES for 4-oxodec-9-en-5-ynal is C=CCCC#CC(=O)CCC=O.
What is the InChIKey of 4-oxodec-9-en-5-ynal?
The InChIKey is HUBULAWQCVBLNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-2-3-4-5-7-10(12)8-6-9-11/h2,9H,1,3-4,6,8H2.
What are the key properties of 4-oxodec-9-en-5-ynal?
4-oxodec-9-en-5-ynal has a molecular weight of 164.20 g/mol, XLogP of 1.50, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxodec-9-en-5-ynal is sourced from PubChem (CID 135043051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).