C13H12Cl2O4S — CID 135043200
ethyl (2E,4E)-5-(3,4-dichlorophenyl)sulfonylpenta-2,4-dienoate (PubChem CID 135043200) has the molecular formula C13H12Cl2O4S and a molecular weight of 335.21 g/mol. Its IUPAC name is ethyl (2E,4E)-5-(3,4-dichlorophenyl)sulfonylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-(3,4-dichlorophenyl)sulfonylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 135043200 |
| Molecular Formula | C13H12Cl2O4S |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | ethyl (2E,4E)-5-(3,4-dichlorophenyl)sulfonylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2O4S/c1-2-19-13(16)5-3-4-8-20(17,18)10-6-7-11(14)12(15)9-10/h3-9H,2H2,1H3/b5-3+,8-4+ |
| InChIKey | OXDYJPMVXGFHSW-MSLMYCKWSA-N |
| XLogP | 3.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|