C13H21NO — CID 135043246
(2S,4R)-2-methylspiro[2,3,5,6,7,8-hexahydro-1H-quinoline-4,2'-oxolane] (PubChem CID 135043246) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (2S,4R)-2-methylspiro[2,3,5,6,7,8-hexahydro-1H-quinoline-4,2'-oxolane].
| Compound Name | (2S,4R)-2-methylspiro[2,3,5,6,7,8-hexahydro-1H-quinoline-4,2'-oxolane] |
|---|---|
| PubChem CID | 135043246 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2S,4R)-2-methylspiro[2,3,5,6,7,8-hexahydro-1H-quinoline-4,2'-oxolane] |
| SMILES | C[C@H]1C[C@]2(CCCO2)C2=C(CCCC2)N1 |
| InChI | InChI=1S/C13H21NO/c1-10-9-13(7-4-8-15-13)11-5-2-3-6-12(11)14-10/h10,14H,2-9H2,1H3/t10-,13+/m0/s1 |
| InChIKey | LRIPEOMXLUHSKA-GXFFZTMASA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |