C12H18O3S2 — CID 135043347
methyl 2-(3-oxocyclohexyl)-1,3-dithiane-2-carboxylate (PubChem CID 135043347) has the molecular formula C12H18O3S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is methyl 2-(3-oxocyclohexyl)-1,3-dithiane-2-carboxylate.
| Compound Name | methyl 2-(3-oxocyclohexyl)-1,3-dithiane-2-carboxylate |
|---|---|
| PubChem CID | 135043347 |
| Molecular Formula | C12H18O3S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | methyl 2-(3-oxocyclohexyl)-1,3-dithiane-2-carboxylate |
| SMILES | COC(=O)C1(C2CCCC(=O)C2)SCCCS1 |
| InChI | InChI=1S/C12H18O3S2/c1-15-11(14)12(16-6-3-7-17-12)9-4-2-5-10(13)8-9/h9H,2-8H2,1H3 |
| InChIKey | KBGJOEKPOCUXCX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |