C15H21NO2 — CID 135043416
(3aS,7aR)-5-benzyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine (PubChem CID 135043416) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (3aS,7aR)-5-benzyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine.
| Compound Name | (3aS,7aR)-5-benzyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 135043416 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (3aS,7aR)-5-benzyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine |
| SMILES | CC1(C)O[C@H]2CN(Cc3ccccc3)CC[C@H]2O1 |
| InChI | InChI=1S/C15H21NO2/c1-15(2)17-13-8-9-16(11-14(13)18-15)10-12-6-4-3-5-7-12/h3-7,13-14H,8-11H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | VBICPVRXPUYDSQ-KGLIPLIRSA-N |
| XLogP | 2.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |