About thiophen-3-yl N,N-diethylcarbamodithioate
thiophen-3-yl N,N-diethylcarbamodithioate (PubChem CID 135043430) has the molecular formula C9H13NS3
and a molecular weight of 231.41 g/mol. Its IUPAC name is thiophen-3-yl N,N-diethylcarbamodithioate.
Molecular Properties
| Compound Name | thiophen-3-yl N,N-diethylcarbamodithioate |
| PubChem CID | 135043430 |
| Molecular Formula | C9H13NS3 |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | thiophen-3-yl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)Sc1ccsc1 |
| InChI | InChI=1S/C9H13NS3/c1-3-10(4-2)9(11)13-8-5-6-12-7-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | GLDCWLGMELQBNP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze thiophen-3-yl N,N-diethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-3-yl N,N-diethylcarbamodithioate?
The IUPAC name of thiophen-3-yl N,N-diethylcarbamodithioate (CID 135043430) is thiophen-3-yl N,N-diethylcarbamodithioate.
What is the SMILES notation for thiophen-3-yl N,N-diethylcarbamodithioate?
The canonical SMILES for thiophen-3-yl N,N-diethylcarbamodithioate is CCN(CC)C(=S)Sc1ccsc1.
What is the InChIKey of thiophen-3-yl N,N-diethylcarbamodithioate?
The InChIKey is GLDCWLGMELQBNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS3/c1-3-10(4-2)9(11)13-8-5-6-12-7-8/h5-7H,3-4H2,1-2H3.
What are the key properties of thiophen-3-yl N,N-diethylcarbamodithioate?
thiophen-3-yl N,N-diethylcarbamodithioate has a molecular weight of 231.41 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-3-yl N,N-diethylcarbamodithioate is sourced from PubChem (CID 135043430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).