About CID 135043437
CID 135043437 (PubChem CID 135043437) has the molecular formula C6H7N2O
and a molecular weight of 123.13 g/mol.
Molecular Properties
| Compound Name | CID 135043437 |
| PubChem CID | 135043437 |
| Molecular Formula | C6H7N2O |
| Molecular Weight | 123.13 g/mol |
| Exact Mass | 123.06 |
| IUPAC Name | — |
| SMILES | NC(=O)C1C=CC=C[N]1 |
| InChI | InChI=1S/C6H7N2O/c7-6(9)5-3-1-2-4-8-5/h1-5H,(H2,7,9) |
| InChIKey | WWHHODIUQJEFLC-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 57.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.13 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 135043437 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135043437?
The IUPAC name of CID 135043437 (CID 135043437) is not available.
What is the SMILES notation for CID 135043437?
The canonical SMILES for CID 135043437 is NC(=O)C1C=CC=C[N]1.
What is the InChIKey of CID 135043437?
The InChIKey is WWHHODIUQJEFLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N2O/c7-6(9)5-3-1-2-4-8-5/h1-5H,(H2,7,9).
What are the key properties of CID 135043437?
CID 135043437 has a molecular weight of 123.13 g/mol, XLogP of -0.47, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135043437 is sourced from PubChem (CID 135043437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).