C10H8N2O2 — CID 135043475
(5Z)-5-[(2,3,5,6-tetradeuterio(413C)cyclohexa-1,3,5-trien-1-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 135043475) has the molecular formula C10H8N2O2 and a molecular weight of 193.20 g/mol. Its IUPAC name is (5Z)-5-[(2,3,5,6-tetradeuterio(413C)cyclohexa-1,3,5-trien-1-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2,3,5,6-tetradeuterio(413C)cyclohexa-1,3,5-trien-1-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 135043475 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (5Z)-5-[(2,3,5,6-tetradeuterio(413C)cyclohexa-1,3,5-trien-1-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | [2H]c1[13cH]c([2H])c([2H])c(/C=C2\NC(=O)NC2=O)c1[2H] |
| InChI | InChI=1S/C10H8N2O2/c13-9-8(11-10(14)12-9)6-7-4-2-1-3-5-7/h1-6H,(H2,11,12,13,14)/b8-6-/i1+1,2D,3D,4D,5D |
| InChIKey | UDTSPKADQGPZFS-XEALOTGBSA-N |
| XLogP | 0.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|