C15H19FO2 — CID 135043508
(2R,4aR,10bR)-9-fluoro-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene (PubChem CID 135043508) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is (2R,4aR,10bR)-9-fluoro-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene.
| Compound Name | (2R,4aR,10bR)-9-fluoro-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
|---|---|
| PubChem CID | 135043508 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2R,4aR,10bR)-9-fluoro-2,5,5-trimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](O1)c1cc(F)ccc1OC2(C)C |
| InChI | InChI=1S/C15H19FO2/c1-9-4-6-12-14(17-9)11-8-10(16)5-7-13(11)18-15(12,2)3/h5,7-9,12,14H,4,6H2,1-3H3/t9-,12-,14+/m1/s1 |
| InChIKey | PPAVETXAWWGVPB-IUPBHXKESA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |