C16H21NO3 — CID 135043656
[(E)-1-(tert-butylamino)-1-oxo-4-phenylbut-3-en-2-yl] acetate (PubChem CID 135043656) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is [(E)-1-(tert-butylamino)-1-oxo-4-phenylbut-3-en-2-yl] acetate.
| Compound Name | [(E)-1-(tert-butylamino)-1-oxo-4-phenylbut-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 135043656 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | [(E)-1-(tert-butylamino)-1-oxo-4-phenylbut-3-en-2-yl] acetate |
| SMILES | CC(=O)OC(/C=C/c1ccccc1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H21NO3/c1-12(18)20-14(15(19)17-16(2,3)4)11-10-13-8-6-5-7-9-13/h5-11,14H,1-4H3,(H,17,19)/b11-10+ |
| InChIKey | BQLCEAHPXNSYDC-ZHACJKMWSA-N |
| XLogP | 2.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |