C10H14NO+ — CID 135043684
6,6-dimethyl-1,2,3,7-tetrahydroindolizin-2-ylium-5-one (PubChem CID 135043684) has the molecular formula C10H14NO+ and a molecular weight of 164.23 g/mol. Its IUPAC name is 6,6-dimethyl-1,2,3,7-tetrahydroindolizin-2-ylium-5-one.
| Compound Name | 6,6-dimethyl-1,2,3,7-tetrahydroindolizin-2-ylium-5-one |
|---|---|
| PubChem CID | 135043684 |
| Molecular Formula | C10H14NO+ |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 6,6-dimethyl-1,2,3,7-tetrahydroindolizin-2-ylium-5-one |
| SMILES | CC1(C)CC=C2C[CH+]CN2C1=O |
| InChI | InChI=1S/C10H14NO/c1-10(2)6-5-8-4-3-7-11(8)9(10)12/h3,5H,4,6-7H2,1-2H3/q+1 |
| InChIKey | NVBPODGSOVLGAP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|