C10H17BF3K — CID 135043778
potassium trifluoro-[(1S,2R,3S,6R)-3,7,7-trimethyl-2-bicyclo[4.1.0]heptanyl]boranuide (PubChem CID 135043778) has the molecular formula C10H17BF3K and a molecular weight of 244.15 g/mol. Its IUPAC name is potassium trifluoro-[(1S,2R,3S,6R)-3,7,7-trimethyl-2-bicyclo[4.1.0]heptanyl]boranuide.
| Compound Name | potassium trifluoro-[(1S,2R,3S,6R)-3,7,7-trimethyl-2-bicyclo[4.1.0]heptanyl]boranuide |
|---|---|
| PubChem CID | 135043778 |
| Molecular Formula | C10H17BF3K |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | potassium trifluoro-[(1S,2R,3S,6R)-3,7,7-trimethyl-2-bicyclo[4.1.0]heptanyl]boranuide |
| SMILES | C[C@H]1CC[C@@H]2[C@H]([C@@H]1[B-](F)(F)F)C2(C)C.[K+] |
| InChI | InChI=1S/C10H17BF3.K/c1-6-4-5-7-8(10(7,2)3)9(6)11(12,13)14;/h6-9H,4-5H2,1-3H3;/q-1;+1/t6-,7+,8+,9+;/m0./s1 |
| InChIKey | NHGNHDHBQVLZIR-WWTDWBKBSA-N |
| XLogP | 0.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|