C14H22O5 — CID 135044036
(3aS,4S,9R,10E,11aR)-4-ethyl-9-hydroxy-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one (PubChem CID 135044036) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is (3aS,4S,9R,10E,11aR)-4-ethyl-9-hydroxy-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one.
| Compound Name | (3aS,4S,9R,10E,11aR)-4-ethyl-9-hydroxy-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one |
|---|---|
| PubChem CID | 135044036 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (3aS,4S,9R,10E,11aR)-4-ethyl-9-hydroxy-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one |
| SMILES | CC[C@@H]1OC(=O)CC[C@@H](O)/C=C/[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H22O5/c1-4-10-13-11(18-14(2,3)19-13)7-5-9(15)6-8-12(16)17-10/h5,7,9-11,13,15H,4,6,8H2,1-3H3/b7-5+/t9-,10-,11+,13-/m0/s1 |
| InChIKey | IJDSDYVVEFJVKV-JAAGBBQGSA-N |
| XLogP | 1.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|