C7H10N2O2 — CID 135044041
(5Z)-5-(2,3,3,3-tetradeuterio-2-(113C)methylpropylidene)imidazolidine-2,4-dione (PubChem CID 135044041) has the molecular formula C7H10N2O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is (5Z)-5-(2,3,3,3-tetradeuterio-2-(113C)methylpropylidene)imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-(2,3,3,3-tetradeuterio-2-(113C)methylpropylidene)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 135044041 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | (5Z)-5-(2,3,3,3-tetradeuterio-2-(113C)methylpropylidene)imidazolidine-2,4-dione |
| SMILES | [2H]C([2H])([2H])C([2H])([13CH3])/C=C1\NC(=O)NC1=O |
| InChI | InChI=1S/C7H10N2O2/c1-4(2)3-5-6(10)9-7(11)8-5/h3-4H,1-2H3,(H2,8,9,10,11)/b5-3-/i1D3,2+1,4D |
| InChIKey | FKEBJFWQLNFBHG-WUJSKZBMSA-N |
| XLogP | 0.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|