C11H14N2OS — CID 135044101
(1R)-1-[(4S)-2-anilino-4,5-dihydro-1,3-thiazol-4-yl]ethanol (PubChem CID 135044101) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is (1R)-1-[(4S)-2-anilino-4,5-dihydro-1,3-thiazol-4-yl]ethanol.
| Compound Name | (1R)-1-[(4S)-2-anilino-4,5-dihydro-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 135044101 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (1R)-1-[(4S)-2-anilino-4,5-dihydro-1,3-thiazol-4-yl]ethanol |
| SMILES | C[C@@H](O)[C@H]1CSC(Nc2ccccc2)=N1 |
| InChI | InChI=1S/C11H14N2OS/c1-8(14)10-7-15-11(13-10)12-9-5-3-2-4-6-9/h2-6,8,10,14H,7H2,1H3,(H,12,13)/t8-,10-/m1/s1 |
| InChIKey | IHIPMPZREBGNDC-PSASIEDQSA-N |
| XLogP | 1.95 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |