C13H16O4 — CID 135044322
7'-oxospiro[1,3-dioxolane-2,3'-2,4,5,6-tetrahydro-1H-naphthalene]-4'a-carbaldehyde (PubChem CID 135044322) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 7'-oxospiro[1,3-dioxolane-2,3'-2,4,5,6-tetrahydro-1H-naphthalene]-4'a-carbaldehyde.
| Compound Name | 7'-oxospiro[1,3-dioxolane-2,3'-2,4,5,6-tetrahydro-1H-naphthalene]-4'a-carbaldehyde |
|---|---|
| PubChem CID | 135044322 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 7'-oxospiro[1,3-dioxolane-2,3'-2,4,5,6-tetrahydro-1H-naphthalene]-4'a-carbaldehyde |
| SMILES | O=CC12CCC(=O)C=C1CCC1(C2)OCCO1 |
| InChI | InChI=1S/C13H16O4/c14-9-12-3-2-11(15)7-10(12)1-4-13(8-12)16-5-6-17-13/h7,9H,1-6,8H2 |
| InChIKey | BMEAQPHEVDNBHD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|