C11H15NO5S — CID 135044366
(3S,6S)-2-(hydroxymethyl)-6-pyridin-2-ylsulfanyloxane-3,4,5-triol (PubChem CID 135044366) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is (3S,6S)-2-(hydroxymethyl)-6-pyridin-2-ylsulfanyloxane-3,4,5-triol.
| Compound Name | (3S,6S)-2-(hydroxymethyl)-6-pyridin-2-ylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 135044366 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (3S,6S)-2-(hydroxymethyl)-6-pyridin-2-ylsulfanyloxane-3,4,5-triol |
| SMILES | OCC1O[C@@H](Sc2ccccn2)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C11H15NO5S/c13-5-6-8(14)9(15)10(16)11(17-6)18-7-3-1-2-4-12-7/h1-4,6,8-11,13-16H,5H2/t6?,8-,9?,10?,11+/m1/s1 |
| InChIKey | QDNKXPNQHJXFPF-ANNXCWHESA-N |
| XLogP | -1.03 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |