About 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one
2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one (PubChem CID 135044486) has the molecular formula C14H17BrN2O
and a molecular weight of 309.21 g/mol. Its IUPAC name is 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one |
| PubChem CID | 135044486 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C(Br)=C(NCc2ccccn2)C1 |
| InChI | InChI=1S/C14H17BrN2O/c1-14(2)7-11(13(15)12(18)8-14)17-9-10-5-3-4-6-16-10/h3-6,17H,7-9H2,1-2H3 |
| InChIKey | BDHQLQCUFUEDPC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one?
The IUPAC name of 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one (CID 135044486) is 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one.
What is the SMILES notation for 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one?
The canonical SMILES for 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one is CC1(C)CC(=O)C(Br)=C(NCc2ccccn2)C1.
What is the InChIKey of 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one?
The InChIKey is BDHQLQCUFUEDPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN2O/c1-14(2)7-11(13(15)12(18)8-14)17-9-10-5-3-4-6-16-10/h3-6,17H,7-9H2,1-2H3.
What are the key properties of 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one?
2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one has a molecular weight of 309.21 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5,5-dimethyl-3-(pyridin-2-ylmethylamino)cyclohex-2-en-1-one is sourced from PubChem (CID 135044486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).