C22H25O4S- — CID 135044559
(2aR,3aR,5S,7aR)-5-hydroxy-2a,7,7a-trimethyl-3,8-dioxo-1-(phenylsulfanylmethyl)-3a,4,5,8a-tetrahydro-2H-cyclobuta[b]naphthalen-1-olate (PubChem CID 135044559) has the molecular formula C22H25O4S- and a molecular weight of 385.50 g/mol. Its IUPAC name is (2aR,3aR,5S,7aR)-5-hydroxy-2a,7,7a-trimethyl-3,8-dioxo-1-(phenylsulfanylmethyl)-3a,4,5,8a-tetrahydro-2H-cyclobuta[b]naphthalen-1-olate.
| Compound Name | (2aR,3aR,5S,7aR)-5-hydroxy-2a,7,7a-trimethyl-3,8-dioxo-1-(phenylsulfanylmethyl)-3a,4,5,8a-tetrahydro-2H-cyclobuta[b]naphthalen-1-olate |
|---|---|
| PubChem CID | 135044559 |
| Molecular Formula | C22H25O4S- |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (2aR,3aR,5S,7aR)-5-hydroxy-2a,7,7a-trimethyl-3,8-dioxo-1-(phenylsulfanylmethyl)-3a,4,5,8a-tetrahydro-2H-cyclobuta[b]naphthalen-1-olate |
| SMILES | CC1=C[C@@H](O)C[C@H]2C(=O)[C@]3(C)CC([O-])(CSc4ccccc4)C3C(=O)[C@@]12C |
| InChI | InChI=1S/C22H25O4S/c1-13-9-14(23)10-16-18(24)20(2)11-22(26,17(20)19(25)21(13,16)3)12-27-15-7-5-4-6-8-15/h4-9,14,16-17,23H,10-12H2,1-3H3/q-1/t14-,16+,17?,20-,21+,22?/m1/s1 |
| InChIKey | SRJMZBPDOTWQHH-OHOMKPDISA-N |
| XLogP | 2.39 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|