C10H12S2 — CID 135044578
(1S,9S)-3,6-dithiatricyclo[7.2.1.02,7]dodeca-2(7),10-diene (PubChem CID 135044578) has the molecular formula C10H12S2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (1S,9S)-3,6-dithiatricyclo[7.2.1.02,7]dodeca-2(7),10-diene.
| Compound Name | (1S,9S)-3,6-dithiatricyclo[7.2.1.02,7]dodeca-2(7),10-diene |
|---|---|
| PubChem CID | 135044578 |
| Molecular Formula | C10H12S2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (1S,9S)-3,6-dithiatricyclo[7.2.1.02,7]dodeca-2(7),10-diene |
| SMILES | C1=C[C@@H]2C[C@H]1CC1=C2SCCS1 |
| InChI | InChI=1S/C10H12S2/c1-2-8-5-7(1)6-9-10(8)12-4-3-11-9/h1-2,7-8H,3-6H2/t7-,8+/m0/s1 |
| InChIKey | IPODHNAGXCRLRE-JGVFFNPUSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|