About (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid
(2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid (PubChem CID 135044621) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid.
Molecular Properties
| Compound Name | (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid |
| PubChem CID | 135044621 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid |
| SMILES | CC(=O)OC([C@@H](C)C(C)=O)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C10H16O5/c1-5(7(3)11)9(15-8(4)12)6(2)10(13)14/h5-6,9H,1-4H3,(H,13,14)/t5-,6+,9?/m0/s1 |
| InChIKey | QBPHSAQWDXNQBY-NSYCXJRNSA-N |
| XLogP | 0.86 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid?
The IUPAC name of (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid (CID 135044621) is (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid.
What is the SMILES notation for (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid?
The canonical SMILES for (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid is CC(=O)OC([C@@H](C)C(C)=O)[C@@H](C)C(=O)O.
What is the InChIKey of (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid?
The InChIKey is QBPHSAQWDXNQBY-NSYCXJRNSA-N. The full InChI is InChI=1S/C10H16O5/c1-5(7(3)11)9(15-8(4)12)6(2)10(13)14/h5-6,9H,1-4H3,(H,13,14)/t5-,6+,9?/m0/s1.
What are the key properties of (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid?
(2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid has a molecular weight of 216.23 g/mol, XLogP of 0.86, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-3-acetyloxy-2,4-dimethyl-5-oxohexanoic acid is sourced from PubChem (CID 135044621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).