About (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium
(2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium (PubChem CID 135044788) has the molecular formula C10H9INO+
and a molecular weight of 286.09 g/mol. Its IUPAC name is (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium.
Molecular Properties
| Compound Name | (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium |
| PubChem CID | 135044788 |
| Molecular Formula | C10H9INO+ |
| Molecular Weight | 286.09 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium |
| SMILES | [IH+]C=C1CN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C10H9INO/c11-6-9-7-12-10(13-9)8-4-2-1-3-5-8/h1-6,11H,7H2/q+1 |
| InChIKey | YRCOFUUBBLTGOX-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.09 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium?
The IUPAC name of (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium (CID 135044788) is (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium.
What is the SMILES notation for (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium?
The canonical SMILES for (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium is [IH+]C=C1CN=C(c2ccccc2)O1.
What is the InChIKey of (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium?
The InChIKey is YRCOFUUBBLTGOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9INO/c11-6-9-7-12-10(13-9)8-4-2-1-3-5-8/h1-6,11H,7H2/q+1.
What are the key properties of (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium?
(2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium has a molecular weight of 286.09 g/mol, XLogP of -1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-4H-1,3-oxazol-5-ylidene)methyliodanium is sourced from PubChem (CID 135044788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).