About S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate
S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate (PubChem CID 135044826) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate.
Molecular Properties
| Compound Name | S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate |
| PubChem CID | 135044826 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate |
| SMILES | C[C@@H](O)[C@@H](C)SC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O2S/c1-8(12)9(2)14-11(13)10-6-4-3-5-7-10/h3-9,12H,1-2H3/t8-,9-/m1/s1 |
| InChIKey | LVNORPQQMKNUCU-RKDXNWHRSA-N |
| XLogP | 2.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate?
The IUPAC name of S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate (CID 135044826) is S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate.
What is the SMILES notation for S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate?
The canonical SMILES for S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate is C[C@@H](O)[C@@H](C)SC(=O)c1ccccc1.
What is the InChIKey of S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate?
The InChIKey is LVNORPQQMKNUCU-RKDXNWHRSA-N. The full InChI is InChI=1S/C11H14O2S/c1-8(12)9(2)14-11(13)10-6-4-3-5-7-10/h3-9,12H,1-2H3/t8-,9-/m1/s1.
What are the key properties of S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate?
S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate has a molecular weight of 210.30 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2R,3R)-3-hydroxybutan-2-yl] benzenecarbothioate is sourced from PubChem (CID 135044826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).