C11H20 — CID 135044861
(1S,2R,3S,6R)-2,3,7,7-tetramethylbicyclo[4.1.0]heptane (PubChem CID 135044861) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (1S,2R,3S,6R)-2,3,7,7-tetramethylbicyclo[4.1.0]heptane.
| Compound Name | (1S,2R,3S,6R)-2,3,7,7-tetramethylbicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 135044861 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (1S,2R,3S,6R)-2,3,7,7-tetramethylbicyclo[4.1.0]heptane |
| SMILES | C[C@H]1[C@H]2[C@@H](CC[C@@H]1C)C2(C)C |
| InChI | InChI=1S/C11H20/c1-7-5-6-9-10(8(7)2)11(9,3)4/h7-10H,5-6H2,1-4H3/t7-,8+,9+,10-/m0/s1 |
| InChIKey | GTQWHVGHXGXYGX-JLIMGVALSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |