C26H30O — CID 135045048
[(1R,2S,6R)-3-methyl-2-(3-methylbut-2-enyl)-6-(4-methylphenyl)cyclohex-3-en-1-yl]-phenylmethanone (PubChem CID 135045048) has the molecular formula C26H30O and a molecular weight of 358.53 g/mol. Its IUPAC name is [(1R,2S,6R)-3-methyl-2-(3-methylbut-2-enyl)-6-(4-methylphenyl)cyclohex-3-en-1-yl]-phenylmethanone.
| Compound Name | [(1R,2S,6R)-3-methyl-2-(3-methylbut-2-enyl)-6-(4-methylphenyl)cyclohex-3-en-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 135045048 |
| Molecular Formula | C26H30O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | [(1R,2S,6R)-3-methyl-2-(3-methylbut-2-enyl)-6-(4-methylphenyl)cyclohex-3-en-1-yl]-phenylmethanone |
| SMILES | CC(C)=CC[C@@H]1C(C)=CC[C@@H](c2ccc(C)cc2)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H30O/c1-18(2)10-16-23-20(4)13-17-24(21-14-11-19(3)12-15-21)25(23)26(27)22-8-6-5-7-9-22/h5-15,23-25H,16-17H2,1-4H3/t23-,24+,25-/m1/s1 |
| InChIKey | BETUBZHJCPQEQV-DSNGMDLFSA-N |
| XLogP | 6.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|