C10H10BrNO2 — CID 135045167
(4S,5S)-5-(bromomethyl)-4-ethenyl-2-(furan-2-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 135045167) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is (4S,5S)-5-(bromomethyl)-4-ethenyl-2-(furan-2-yl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-5-(bromomethyl)-4-ethenyl-2-(furan-2-yl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 135045167 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | (4S,5S)-5-(bromomethyl)-4-ethenyl-2-(furan-2-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | C=C[C@@H]1N=C(c2ccco2)O[C@@H]1CBr |
| InChI | InChI=1S/C10H10BrNO2/c1-2-7-9(6-11)14-10(12-7)8-4-3-5-13-8/h2-5,7,9H,1,6H2/t7-,9+/m0/s1 |
| InChIKey | GARYYISXNRFWCK-IONNQARKSA-N |
| XLogP | 2.37 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|