C13H18ClNO2 — CID 135045174
(3aS,6aR)-3a-acetyl-5-(chloromethyl)-2-prop-2-enyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-3-one (PubChem CID 135045174) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is (3aS,6aR)-3a-acetyl-5-(chloromethyl)-2-prop-2-enyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-3-one.
| Compound Name | (3aS,6aR)-3a-acetyl-5-(chloromethyl)-2-prop-2-enyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-3-one |
|---|---|
| PubChem CID | 135045174 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (3aS,6aR)-3a-acetyl-5-(chloromethyl)-2-prop-2-enyl-4,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-3-one |
| SMILES | C=CCN1C[C@@H]2CC(CCl)C[C@]2(C(C)=O)C1=O |
| InChI | InChI=1S/C13H18ClNO2/c1-3-4-15-8-11-5-10(7-14)6-13(11,9(2)16)12(15)17/h3,10-11H,1,4-8H2,2H3/t10?,11-,13+/m0/s1 |
| InChIKey | SXJSHQXVXUSCCU-QMDRTORHSA-N |
| XLogP | 1.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|