C10H16O2 — CID 135045203
(3aR,6S,7aS)-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one (PubChem CID 135045203) has the molecular formula C10H16O2 and a molecular weight of 168.23 g/mol. Its IUPAC name is (3aR,6S,7aS)-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one.
| Compound Name | (3aR,6S,7aS)-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 135045203 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.23 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3aR,6S,7aS)-3,6-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
| SMILES | C[C@H]1CC[C@H]2[C@H](C1)OC(=O)C2C |
| InChI | InChI=1S/C10H16O2/c1-6-3-4-8-7(2)10(11)12-9(8)5-6/h6-9H,3-5H2,1-2H3/t6-,7?,8+,9-/m0/s1 |
| InChIKey | FGDINYRLQOKVQS-ZZMKPFPKSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | 200 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |