C9H12O3 — CID 135045387
(4aS)-4-hydroxy-4a,5,6,7,8,8a-hexahydrochromen-2-one (PubChem CID 135045387) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is (4aS)-4-hydroxy-4a,5,6,7,8,8a-hexahydrochromen-2-one.
| Compound Name | (4aS)-4-hydroxy-4a,5,6,7,8,8a-hexahydrochromen-2-one |
|---|---|
| PubChem CID | 135045387 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (4aS)-4-hydroxy-4a,5,6,7,8,8a-hexahydrochromen-2-one |
| SMILES | O=C1C=C(O)[C@H]2CCCCC2O1 |
| InChI | InChI=1S/C9H12O3/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h5-6,8,10H,1-4H2/t6-,8?/m1/s1 |
| InChIKey | YSHFERUTEJAGNO-XPJFZRNWSA-N |
| XLogP | 1.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |