C13H19ClO2 — CID 135045415
(3aR,7aS)-5-(1-chloro-2-methylpropan-2-yl)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole (PubChem CID 135045415) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is (3aR,7aS)-5-(1-chloro-2-methylpropan-2-yl)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole.
| Compound Name | (3aR,7aS)-5-(1-chloro-2-methylpropan-2-yl)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 135045415 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (3aR,7aS)-5-(1-chloro-2-methylpropan-2-yl)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole |
| SMILES | CC1(C)O[C@H]2C=CC(C(C)(C)CCl)=C[C@H]2O1 |
| InChI | InChI=1S/C13H19ClO2/c1-12(2,8-14)9-5-6-10-11(7-9)16-13(3,4)15-10/h5-7,10-11H,8H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | GZFLKLNTRRIYKN-WDEREUQCSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|