About 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal
2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal (PubChem CID 135045523) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal.
Molecular Properties
| Compound Name | 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal |
| PubChem CID | 135045523 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal |
| SMILES | C=CC1(C)CC2(CCC1C(=C)C=O)OCCO2 |
| InChI | InChI=1S/C14H20O3/c1-4-13(3)10-14(16-7-8-17-14)6-5-12(13)11(2)9-15/h4,9,12H,1-2,5-8,10H2,3H3 |
| InChIKey | PEUSRARXEAKHAH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal?
The IUPAC name of 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal (CID 135045523) is 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal.
What is the SMILES notation for 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal?
The canonical SMILES for 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal is C=CC1(C)CC2(CCC1C(=C)C=O)OCCO2.
What is the InChIKey of 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal?
The InChIKey is PEUSRARXEAKHAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-4-13(3)10-14(16-7-8-17-14)6-5-12(13)11(2)9-15/h4,9,12H,1-2,5-8,10H2,3H3.
What are the key properties of 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal?
2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal has a molecular weight of 236.31 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-ethenyl-7-methyl-1,4-dioxaspiro[4.5]decan-8-yl)prop-2-enal is sourced from PubChem (CID 135045523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).