C15H16O2 — CID 135045524
(9S,10R,12S)-4,9,13-trimethyl-6-oxatetracyclo[7.4.0.03,7.010,12]trideca-1(13),3(7),4-trien-8-one (PubChem CID 135045524) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (9S,10R,12S)-4,9,13-trimethyl-6-oxatetracyclo[7.4.0.03,7.010,12]trideca-1(13),3(7),4-trien-8-one.
| Compound Name | (9S,10R,12S)-4,9,13-trimethyl-6-oxatetracyclo[7.4.0.03,7.010,12]trideca-1(13),3(7),4-trien-8-one |
|---|---|
| PubChem CID | 135045524 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (9S,10R,12S)-4,9,13-trimethyl-6-oxatetracyclo[7.4.0.03,7.010,12]trideca-1(13),3(7),4-trien-8-one |
| SMILES | CC1=C2Cc3c(C)coc3C(=O)[C@@]2(C)[C@@H]2C[C@H]12 |
| InChI | InChI=1S/C15H16O2/c1-7-6-17-13-9(7)4-11-8(2)10-5-12(10)15(11,3)14(13)16/h6,10,12H,4-5H2,1-3H3/t10-,12-,15-/m1/s1 |
| InChIKey | JVBXLJLNZSKRPA-IXPVHAAZSA-N |
| XLogP | 3.30 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|