C11H16N2O3S — CID 135045721
S-[[(3R)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl] propanethioate (PubChem CID 135045721) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is S-[[(3R)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl] propanethioate.
| Compound Name | S-[[(3R)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl] propanethioate |
|---|---|
| PubChem CID | 135045721 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | S-[[(3R)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl] propanethioate |
| SMILES | CCC(=O)SC[C@@H]1NC(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C11H16N2O3S/c1-2-9(14)17-6-7-11(16)13-5-3-4-8(13)10(15)12-7/h7-8H,2-6H2,1H3,(H,12,15)/t7-,8?/m0/s1 |
| InChIKey | OQLKFNBKGQIIEE-JAMMHHFISA-N |
| XLogP | 0.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|