C15H24O2 — CID 135045786
(3aS,6R,7R,7aR)-7-(hydroxymethyl)-3a-methyl-3-methylidene-6-propan-2-yl-1,2,5,6,7,7a-hexahydroinden-4-one (PubChem CID 135045786) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (3aS,6R,7R,7aR)-7-(hydroxymethyl)-3a-methyl-3-methylidene-6-propan-2-yl-1,2,5,6,7,7a-hexahydroinden-4-one.
| Compound Name | (3aS,6R,7R,7aR)-7-(hydroxymethyl)-3a-methyl-3-methylidene-6-propan-2-yl-1,2,5,6,7,7a-hexahydroinden-4-one |
|---|---|
| PubChem CID | 135045786 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3aS,6R,7R,7aR)-7-(hydroxymethyl)-3a-methyl-3-methylidene-6-propan-2-yl-1,2,5,6,7,7a-hexahydroinden-4-one |
| SMILES | C=C1CC[C@@H]2[C@H](CO)[C@@H](C(C)C)CC(=O)[C@]12C |
| InChI | InChI=1S/C15H24O2/c1-9(2)11-7-14(17)15(4)10(3)5-6-13(15)12(11)8-16/h9,11-13,16H,3,5-8H2,1-2,4H3/t11-,12-,13-,15-/m1/s1 |
| InChIKey | SLVOOYPOTQGEAN-RGCMKSIDSA-N |
| XLogP | 2.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|