C13H16CuN — CID 135046006
copper(1+);N-cyclohexyl-1-phenylmethanimine (PubChem CID 135046006) has the molecular formula C13H16CuN and a molecular weight of 249.82 g/mol. Its IUPAC name is copper(1+);N-cyclohexyl-1-phenylmethanimine.
| Compound Name | copper(1+);N-cyclohexyl-1-phenylmethanimine |
|---|---|
| PubChem CID | 135046006 |
| Molecular Formula | C13H16CuN |
| Molecular Weight | 249.82 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | copper(1+);N-cyclohexyl-1-phenylmethanimine |
| SMILES | [Cu+].[c-]1ccccc1/C=N/C1CCCCC1 |
| InChI | InChI=1S/C13H16N.Cu/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;/h1,3-4,7,11,13H,2,5-6,9-10H2;/q-1;+1/b14-11+; |
| InChIKey | HPACVIJLUQQFOK-JHGYPSGKSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|